methyl 2-(2,4-dichlorophenyl)-2-(2-fluoroanilino)acetate

C15H12Cl2FNO2 — CID 61001245

IUPACmethyl 2-(2,4-dichlorophenyl)-2-(2-fluoroanilino)acetate
SMILESCOC(=O)C(Nc1ccccc1F)c1ccc(Cl)cc1Cl
InChIInChI=1S/C15H12Cl2FNO2/c1-21-15(20)14(10-7-6-9(16)8-11(10)17)19-13-5-3-2-4-12(13)18/h2-8,14,19H,1H3
InChIKeySPYKQAMKBFMYEI-UHFFFAOYSA-N
MW328.17 g/mol
LogP4.46
Rot. Bonds4

About methyl 2-(2,4-dichlorophenyl)-2-(2-fluoroanilino)acetate

methyl 2-(2,4-dichlorophenyl)-2-(2-fluoroanilino)acetate (PubChem CID 61001245) has the molecular formula C15H12Cl2FNO2 and a molecular weight of 328.17 g/mol. Its IUPAC name is methyl 2-(2,4-dichlorophenyl)-2-(2-fluoroanilino)acetate.

Molecular Properties

Compound Namemethyl 2-(2,4-dichlorophenyl)-2-(2-fluoroanilino)acetate
PubChem CID61001245
Molecular FormulaC15H12Cl2FNO2
Molecular Weight328.17 g/mol
Exact Mass327.02
IUPAC Namemethyl 2-(2,4-dichlorophenyl)-2-(2-fluoroanilino)acetate
SMILESCOC(=O)C(Nc1ccccc1F)c1ccc(Cl)cc1Cl
InChIInChI=1S/C15H12Cl2FNO2/c1-21-15(20)14(10-7-6-9(16)8-11(10)17)19-13-5-3-2-4-12(13)18/h2-8,14,19H,1H3
InChIKeySPYKQAMKBFMYEI-UHFFFAOYSA-N
XLogP4.46
TPSA38.33 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms21
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500328.17
LogP ≤ 54.46
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze methyl 2-(2,4-dichlorophenyl)-2-(2-fluoroanilino)acetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-(2,4-dichlorophenyl)-2-(2-fluoroanilino)acetate?
The IUPAC name of methyl 2-(2,4-dichlorophenyl)-2-(2-fluoroanilino)acetate (CID 61001245) is methyl 2-(2,4-dichlorophenyl)-2-(2-fluoroanilino)acetate.
What is the SMILES notation for methyl 2-(2,4-dichlorophenyl)-2-(2-fluoroanilino)acetate?
The canonical SMILES for methyl 2-(2,4-dichlorophenyl)-2-(2-fluoroanilino)acetate is COC(=O)C(Nc1ccccc1F)c1ccc(Cl)cc1Cl.
What is the InChIKey of methyl 2-(2,4-dichlorophenyl)-2-(2-fluoroanilino)acetate?
The InChIKey is SPYKQAMKBFMYEI-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12Cl2FNO2/c1-21-15(20)14(10-7-6-9(16)8-11(10)17)19-13-5-3-2-4-12(13)18/h2-8,14,19H,1H3.
What are the key properties of methyl 2-(2,4-dichlorophenyl)-2-(2-fluoroanilino)acetate?
methyl 2-(2,4-dichlorophenyl)-2-(2-fluoroanilino)acetate has a molecular weight of 328.17 g/mol, XLogP of 4.46, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(2,4-dichlorophenyl)-2-(2-fluoroanilino)acetate is sourced from PubChem (CID 61001245), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).