C15H12Cl2FNO2 — CID 61001245
methyl 2-(2,4-dichlorophenyl)-2-(2-fluoroanilino)acetate (PubChem CID 61001245) has the molecular formula C15H12Cl2FNO2 and a molecular weight of 328.17 g/mol. Its IUPAC name is methyl 2-(2,4-dichlorophenyl)-2-(2-fluoroanilino)acetate.
| Compound Name | methyl 2-(2,4-dichlorophenyl)-2-(2-fluoroanilino)acetate |
|---|---|
| PubChem CID | 61001245 |
| Molecular Formula | C15H12Cl2FNO2 |
| Molecular Weight | 328.17 g/mol |
| Exact Mass | 327.02 |
| IUPAC Name | methyl 2-(2,4-dichlorophenyl)-2-(2-fluoroanilino)acetate |
| SMILES | COC(=O)C(Nc1ccccc1F)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C15H12Cl2FNO2/c1-21-15(20)14(10-7-6-9(16)8-11(10)17)19-13-5-3-2-4-12(13)18/h2-8,14,19H,1H3 |
| InChIKey | SPYKQAMKBFMYEI-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.17 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |