C12H17ClN2O2 — CID 171250563
methyl (3R)-3-amino-3-[2-chloro-4-(dimethylamino)phenyl]propanoate (PubChem CID 171250563) has the molecular formula C12H17ClN2O2 and a molecular weight of 256.73 g/mol. Its IUPAC name is methyl (3R)-3-amino-3-[2-chloro-4-(dimethylamino)phenyl]propanoate.
| Compound Name | methyl (3R)-3-amino-3-[2-chloro-4-(dimethylamino)phenyl]propanoate |
|---|---|
| PubChem CID | 171250563 |
| Molecular Formula | C12H17ClN2O2 |
| Molecular Weight | 256.73 g/mol |
| Exact Mass | 256.10 |
| IUPAC Name | methyl (3R)-3-amino-3-[2-chloro-4-(dimethylamino)phenyl]propanoate |
| SMILES | COC(=O)C[C@@H](N)c1ccc(N(C)C)cc1Cl |
| InChI | InChI=1S/C12H17ClN2O2/c1-15(2)8-4-5-9(10(13)6-8)11(14)7-12(16)17-3/h4-6,11H,7,14H2,1-3H3/t11-/m1/s1 |
| InChIKey | RCXWFVYPLASTEH-LLVKDONJSA-N |
| XLogP | 1.97 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.73 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |