C12H20Cl2N2O — CID 171212662
(4R)-4-amino-4-[2-chloro-4-(dimethylamino)phenyl]butan-1-ol;hydrochloride (PubChem CID 171212662) has the molecular formula C12H20Cl2N2O and a molecular weight of 279.21 g/mol. Its IUPAC name is (4R)-4-amino-4-[2-chloro-4-(dimethylamino)phenyl]butan-1-ol;hydrochloride.
| Compound Name | (4R)-4-amino-4-[2-chloro-4-(dimethylamino)phenyl]butan-1-ol;hydrochloride |
|---|---|
| PubChem CID | 171212662 |
| Molecular Formula | C12H20Cl2N2O |
| Molecular Weight | 279.21 g/mol |
| Exact Mass | 278.10 |
| IUPAC Name | (4R)-4-amino-4-[2-chloro-4-(dimethylamino)phenyl]butan-1-ol;hydrochloride |
| SMILES | CN(C)c1ccc([C@H](N)CCCO)c(Cl)c1.Cl |
| InChI | InChI=1S/C12H19ClN2O.ClH/c1-15(2)9-5-6-10(11(13)8-9)12(14)4-3-7-16;/h5-6,8,12,16H,3-4,7,14H2,1-2H3;1H/t12-;/m1./s1 |
| InChIKey | JANJIGAKEHBONZ-UTONKHPSSA-N |
| XLogP | 2.60 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.21 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |