C13H20Cl2N2 — CID 171212647
4-[(1R)-1-aminopent-4-enyl]-3-chloro-N,N-dimethylaniline;hydrochloride (PubChem CID 171212647) has the molecular formula C13H20Cl2N2 and a molecular weight of 275.22 g/mol. Its IUPAC name is 4-[(1R)-1-aminopent-4-enyl]-3-chloro-N,N-dimethylaniline;hydrochloride.
| Compound Name | 4-[(1R)-1-aminopent-4-enyl]-3-chloro-N,N-dimethylaniline;hydrochloride |
|---|---|
| PubChem CID | 171212647 |
| Molecular Formula | C13H20Cl2N2 |
| Molecular Weight | 275.22 g/mol |
| Exact Mass | 274.10 |
| IUPAC Name | 4-[(1R)-1-aminopent-4-enyl]-3-chloro-N,N-dimethylaniline;hydrochloride |
| SMILES | C=CCC[C@@H](N)c1ccc(N(C)C)cc1Cl.Cl |
| InChI | InChI=1S/C13H19ClN2.ClH/c1-4-5-6-13(15)11-8-7-10(16(2)3)9-12(11)14;/h4,7-9,13H,1,5-6,15H2,2-3H3;1H/t13-;/m1./s1 |
| InChIKey | QSCUKVOHEGKFCY-BTQNPOSSSA-N |
| XLogP | 3.79 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.22 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|