C13H22ClN3 — CID 171232219
(1S)-1-[2-chloro-4-(dimethylamino)phenyl]pentane-1,5-diamine (PubChem CID 171232219) has the molecular formula C13H22ClN3 and a molecular weight of 255.79 g/mol. Its IUPAC name is (1S)-1-[2-chloro-4-(dimethylamino)phenyl]pentane-1,5-diamine.
| Compound Name | (1S)-1-[2-chloro-4-(dimethylamino)phenyl]pentane-1,5-diamine |
|---|---|
| PubChem CID | 171232219 |
| Molecular Formula | C13H22ClN3 |
| Molecular Weight | 255.79 g/mol |
| Exact Mass | 255.15 |
| IUPAC Name | (1S)-1-[2-chloro-4-(dimethylamino)phenyl]pentane-1,5-diamine |
| SMILES | CN(C)c1ccc([C@@H](N)CCCCN)c(Cl)c1 |
| InChI | InChI=1S/C13H22ClN3/c1-17(2)10-6-7-11(12(14)9-10)13(16)5-3-4-8-15/h6-7,9,13H,3-5,8,15-16H2,1-2H3/t13-/m0/s1 |
| InChIKey | ZFRAYUYVEDQBQP-ZDUSSCGKSA-N |
| XLogP | 2.53 |
| TPSA | 55.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.79 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|