C20H28O — CID 63410825
1-(1-adamantyl)-2-(2,5-dimethylphenyl)ethanol (PubChem CID 63410825) has the molecular formula C20H28O and a molecular weight of 284.44 g/mol. Its IUPAC name is 1-(1-adamantyl)-2-(2,5-dimethylphenyl)ethanol.
| Compound Name | 1-(1-adamantyl)-2-(2,5-dimethylphenyl)ethanol |
|---|---|
| PubChem CID | 63410825 |
| Molecular Formula | C20H28O |
| Molecular Weight | 284.44 g/mol |
| Exact Mass | 284.21 |
| IUPAC Name | 1-(1-adamantyl)-2-(2,5-dimethylphenyl)ethanol |
| SMILES | Cc1ccc(C)c(CC(O)C23CC4CC(CC(C4)C2)C3)c1 |
| InChI | InChI=1S/C20H28O/c1-13-3-4-14(2)18(5-13)9-19(21)20-10-15-6-16(11-20)8-17(7-15)12-20/h3-5,15-17,19,21H,6-12H2,1-2H3 |
| InChIKey | UYMWCTBKWLLLMB-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.44 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |