C20H27Cl — CID 79987672
1-[2-chloro-2-(2,4-dimethylphenyl)ethyl]adamantane (PubChem CID 79987672) has the molecular formula C20H27Cl and a molecular weight of 302.89 g/mol. Its IUPAC name is 1-[2-chloro-2-(2,4-dimethylphenyl)ethyl]adamantane.
| Compound Name | 1-[2-chloro-2-(2,4-dimethylphenyl)ethyl]adamantane |
|---|---|
| PubChem CID | 79987672 |
| Molecular Formula | C20H27Cl |
| Molecular Weight | 302.89 g/mol |
| Exact Mass | 302.18 |
| IUPAC Name | 1-[2-chloro-2-(2,4-dimethylphenyl)ethyl]adamantane |
| SMILES | Cc1ccc(C(Cl)CC23CC4CC(CC(C4)C2)C3)c(C)c1 |
| InChI | InChI=1S/C20H27Cl/c1-13-3-4-18(14(2)5-13)19(21)12-20-9-15-6-16(10-20)8-17(7-15)11-20/h3-5,15-17,19H,6-12H2,1-2H3 |
| InChIKey | CMTHPZZZGZZDSH-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.89 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|