C20H29N — CID 79988911
2-(1-adamantyl)-1-(2,5-dimethylphenyl)ethanamine (PubChem CID 79988911) has the molecular formula C20H29N and a molecular weight of 283.46 g/mol. Its IUPAC name is 2-(1-adamantyl)-1-(2,5-dimethylphenyl)ethanamine.
| Compound Name | 2-(1-adamantyl)-1-(2,5-dimethylphenyl)ethanamine |
|---|---|
| PubChem CID | 79988911 |
| Molecular Formula | C20H29N |
| Molecular Weight | 283.46 g/mol |
| Exact Mass | 283.23 |
| IUPAC Name | 2-(1-adamantyl)-1-(2,5-dimethylphenyl)ethanamine |
| SMILES | Cc1ccc(C)c(C(N)CC23CC4CC(CC(C4)C2)C3)c1 |
| InChI | InChI=1S/C20H29N/c1-13-3-4-14(2)18(5-13)19(21)12-20-9-15-6-16(10-20)8-17(7-15)11-20/h3-5,15-17,19H,6-12,21H2,1-2H3 |
| InChIKey | ASOIGAVAVXLBAO-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.46 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |