C18H28N2O2S — CID 19652654
1-(2,5-dimethoxyphenyl)-3-(3,3,5-trimethylcyclohexyl)thiourea (PubChem CID 19652654) has the molecular formula C18H28N2O2S and a molecular weight of 336.50 g/mol. Its IUPAC name is 1-(2,5-dimethoxyphenyl)-3-(3,3,5-trimethylcyclohexyl)thiourea.
| Compound Name | 1-(2,5-dimethoxyphenyl)-3-(3,3,5-trimethylcyclohexyl)thiourea |
|---|---|
| PubChem CID | 19652654 |
| Molecular Formula | C18H28N2O2S |
| Molecular Weight | 336.50 g/mol |
| Exact Mass | 336.19 |
| IUPAC Name | 1-(2,5-dimethoxyphenyl)-3-(3,3,5-trimethylcyclohexyl)thiourea |
| SMILES | COc1ccc(OC)c(NC(=S)NC2CC(C)CC(C)(C)C2)c1 |
| InChI | InChI=1S/C18H28N2O2S/c1-12-8-13(11-18(2,3)10-12)19-17(23)20-15-9-14(21-4)6-7-16(15)22-5/h6-7,9,12-13H,8,10-11H2,1-5H3,(H2,19,20,23) |
| InChIKey | PFTDMLFSHCILNB-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.50 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|