C20H32N2S — CID 124836687
1-[(1R,2R,6R,7S,8R)-8-tricyclo[5.2.1.02,6]dec-4-enyl]-3-[(1S,5S)-3,3,5-trimethylcyclohexyl]thiourea (PubChem CID 124836687) has the molecular formula C20H32N2S and a molecular weight of 332.56 g/mol. Its IUPAC name is 1-[(1R,2R,6R,7S,8R)-8-tricyclo[5.2.1.02,6]dec-4-enyl]-3-[(1S,5S)-3,3,5-trimethylcyclohexyl]thiourea.
| Compound Name | 1-[(1R,2R,6R,7S,8R)-8-tricyclo[5.2.1.02,6]dec-4-enyl]-3-[(1S,5S)-3,3,5-trimethylcyclohexyl]thiourea |
|---|---|
| PubChem CID | 124836687 |
| Molecular Formula | C20H32N2S |
| Molecular Weight | 332.56 g/mol |
| Exact Mass | 332.23 |
| IUPAC Name | 1-[(1R,2R,6R,7S,8R)-8-tricyclo[5.2.1.02,6]dec-4-enyl]-3-[(1S,5S)-3,3,5-trimethylcyclohexyl]thiourea |
| SMILES | C[C@@H]1C[C@H](NC(=S)N[C@@H]2C[C@H]3C[C@H]2[C@@H]2C=CC[C@H]32)CC(C)(C)C1 |
| InChI | InChI=1S/C20H32N2S/c1-12-7-14(11-20(2,3)10-12)21-19(23)22-18-9-13-8-17(18)16-6-4-5-15(13)16/h4,6,12-18H,5,7-11H2,1-3H3,(H2,21,22,23)/t12-,13-,14+,15-,16-,17+,18-/m1/s1 |
| InChIKey | DZRCPDNBURVKIV-ZNLWFRPKSA-N |
| XLogP | 4.27 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.56 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|