C20H26N2S — CID 98080246
1-(4-propan-2-ylphenyl)-3-[(1S,2R,6S,7R,8S)-8-tricyclo[5.2.1.02,6]dec-4-enyl]thiourea (PubChem CID 98080246) has the molecular formula C20H26N2S and a molecular weight of 326.51 g/mol. Its IUPAC name is 1-(4-propan-2-ylphenyl)-3-[(1S,2R,6S,7R,8S)-8-tricyclo[5.2.1.02,6]dec-4-enyl]thiourea.
| Compound Name | 1-(4-propan-2-ylphenyl)-3-[(1S,2R,6S,7R,8S)-8-tricyclo[5.2.1.02,6]dec-4-enyl]thiourea |
|---|---|
| PubChem CID | 98080246 |
| Molecular Formula | C20H26N2S |
| Molecular Weight | 326.51 g/mol |
| Exact Mass | 326.18 |
| IUPAC Name | 1-(4-propan-2-ylphenyl)-3-[(1S,2R,6S,7R,8S)-8-tricyclo[5.2.1.02,6]dec-4-enyl]thiourea |
| SMILES | CC(C)c1ccc(NC(=S)N[C@H]2C[C@@H]3C[C@@H]2[C@H]2C=CC[C@H]32)cc1 |
| InChI | InChI=1S/C20H26N2S/c1-12(2)13-6-8-15(9-7-13)21-20(23)22-19-11-14-10-18(19)17-5-3-4-16(14)17/h3,5-9,12,14,16-19H,4,10-11H2,1-2H3,(H2,21,22,23)/t14-,16+,17-,18+,19-/m0/s1 |
| InChIKey | PBMKSBCBTDGDDZ-YYTXDEJISA-N |
| XLogP | 4.70 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.51 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|