C11H16N2S — CID 98083241
[(1R,2S,6S,7S,8R)-8-tricyclo[5.2.1.02,6]dec-4-enyl]thiourea (PubChem CID 98083241) has the molecular formula C11H16N2S and a molecular weight of 208.33 g/mol. Its IUPAC name is [(1R,2S,6S,7S,8R)-8-tricyclo[5.2.1.02,6]dec-4-enyl]thiourea.
| Compound Name | [(1R,2S,6S,7S,8R)-8-tricyclo[5.2.1.02,6]dec-4-enyl]thiourea |
|---|---|
| PubChem CID | 98083241 |
| Molecular Formula | C11H16N2S |
| Molecular Weight | 208.33 g/mol |
| Exact Mass | 208.10 |
| IUPAC Name | [(1R,2S,6S,7S,8R)-8-tricyclo[5.2.1.02,6]dec-4-enyl]thiourea |
| SMILES | NC(=S)N[C@@H]1C[C@H]2C[C@H]1[C@H]1C=CC[C@@H]21 |
| InChI | InChI=1S/C11H16N2S/c12-11(14)13-10-5-6-4-9(10)8-3-1-2-7(6)8/h1,3,6-10H,2,4-5H2,(H3,12,13,14)/t6-,7+,8+,9+,10-/m1/s1 |
| InChIKey | DHWGVLNGJNHMLY-SQQIUAQRSA-N |
| XLogP | 1.42 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.33 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|