C19H21N3O2S — CID 124837208
5-nitro-N-[(1R,2R,6R,7S,8R)-8-tricyclo[5.2.1.02,6]dec-4-enyl]-2,3-dihydroindole-1-carbothioamide (PubChem CID 124837208) has the molecular formula C19H21N3O2S and a molecular weight of 355.46 g/mol. Its IUPAC name is 5-nitro-N-[(1R,2R,6R,7S,8R)-8-tricyclo[5.2.1.02,6]dec-4-enyl]-2,3-dihydroindole-1-carbothioamide.
| Compound Name | 5-nitro-N-[(1R,2R,6R,7S,8R)-8-tricyclo[5.2.1.02,6]dec-4-enyl]-2,3-dihydroindole-1-carbothioamide |
|---|---|
| PubChem CID | 124837208 |
| Molecular Formula | C19H21N3O2S |
| Molecular Weight | 355.46 g/mol |
| Exact Mass | 355.14 |
| IUPAC Name | 5-nitro-N-[(1R,2R,6R,7S,8R)-8-tricyclo[5.2.1.02,6]dec-4-enyl]-2,3-dihydroindole-1-carbothioamide |
| SMILES | O=[N+]([O-])c1ccc2c(c1)CCN2C(=S)N[C@@H]1C[C@H]2C[C@H]1[C@@H]1C=CC[C@H]21 |
| InChI | InChI=1S/C19H21N3O2S/c23-22(24)13-4-5-18-11(8-13)6-7-21(18)19(25)20-17-10-12-9-16(17)15-3-1-2-14(12)15/h1,3-5,8,12,14-17H,2,6-7,9-10H2,(H,20,25)/t12-,14-,15-,16+,17-/m1/s1 |
| InChIKey | WUNPKLOXXFBLCB-FYNNLBNCSA-N |
| XLogP | 3.43 |
| TPSA | 58.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.46 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|