C18H19Br2N3OS — CID 137240604
1-[(E)-(3,5-dibromo-2-hydroxyphenyl)methylideneamino]-3-(8-tricyclo[5.2.1.02,6]dec-4-enyl)thiourea (PubChem CID 137240604) has the molecular formula C18H19Br2N3OS and a molecular weight of 485.25 g/mol. Its IUPAC name is 1-[(E)-(3,5-dibromo-2-hydroxyphenyl)methylideneamino]-3-(8-tricyclo[5.2.1.02,6]dec-4-enyl)thiourea.
| Compound Name | 1-[(E)-(3,5-dibromo-2-hydroxyphenyl)methylideneamino]-3-(8-tricyclo[5.2.1.02,6]dec-4-enyl)thiourea |
|---|---|
| PubChem CID | 137240604 |
| Molecular Formula | C18H19Br2N3OS |
| Molecular Weight | 485.25 g/mol |
| Exact Mass | 482.96 |
| IUPAC Name | 1-[(E)-(3,5-dibromo-2-hydroxyphenyl)methylideneamino]-3-(8-tricyclo[5.2.1.02,6]dec-4-enyl)thiourea |
| SMILES | Oc1c(Br)cc(Br)cc1/C=N/NC(=S)NC1CC2CC1C1C=CCC21 |
| InChI | InChI=1S/C18H19Br2N3OS/c19-11-4-10(17(24)15(20)7-11)8-21-23-18(25)22-16-6-9-5-14(16)13-3-1-2-12(9)13/h1,3-4,7-9,12-14,16,24H,2,5-6H2,(H2,22,23,25)/b21-8+ |
| InChIKey | FRCWTVPUNNXLAC-ODCIPOBUSA-N |
| XLogP | 4.32 |
| TPSA | 56.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.25 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|