C13H15N3O2S — CID 99937052
1-[(1S,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]-3-(furan-2-carbonylamino)thiourea (PubChem CID 99937052) has the molecular formula C13H15N3O2S and a molecular weight of 277.35 g/mol. Its IUPAC name is 1-[(1S,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]-3-(furan-2-carbonylamino)thiourea.
| Compound Name | 1-[(1S,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]-3-(furan-2-carbonylamino)thiourea |
|---|---|
| PubChem CID | 99937052 |
| Molecular Formula | C13H15N3O2S |
| Molecular Weight | 277.35 g/mol |
| Exact Mass | 277.09 |
| IUPAC Name | 1-[(1S,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]-3-(furan-2-carbonylamino)thiourea |
| SMILES | O=C(NNC(=S)N[C@H]1C[C@H]2C=C[C@@H]1C2)c1ccco1 |
| InChI | InChI=1S/C13H15N3O2S/c17-12(11-2-1-5-18-11)15-16-13(19)14-10-7-8-3-4-9(10)6-8/h1-5,8-10H,6-7H2,(H,15,17)(H2,14,16,19)/t8-,9+,10-/m0/s1 |
| InChIKey | GHSMDSWUHSMKJB-AEJSXWLSSA-N |
| XLogP | 1.35 |
| TPSA | 66.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.35 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|