C10H15ClF3NO2S — CID 160966528
N-(2-bicyclo[2.2.1]hept-5-enylmethyl)-1,1,1-trifluoromethanesulfonamide;chloromethane (PubChem CID 160966528) has the molecular formula C10H15ClF3NO2S and a molecular weight of 305.75 g/mol. Its IUPAC name is N-(2-bicyclo[2.2.1]hept-5-enylmethyl)-1,1,1-trifluoromethanesulfonamide;chloromethane.
| Compound Name | N-(2-bicyclo[2.2.1]hept-5-enylmethyl)-1,1,1-trifluoromethanesulfonamide;chloromethane |
|---|---|
| PubChem CID | 160966528 |
| Molecular Formula | C10H15ClF3NO2S |
| Molecular Weight | 305.75 g/mol |
| Exact Mass | 305.05 |
| IUPAC Name | N-(2-bicyclo[2.2.1]hept-5-enylmethyl)-1,1,1-trifluoromethanesulfonamide;chloromethane |
| SMILES | CCl.O=S(=O)(NCC1CC2C=CC1C2)C(F)(F)F |
| InChI | InChI=1S/C9H12F3NO2S.CH3Cl/c10-9(11,12)16(14,15)13-5-8-4-6-1-2-7(8)3-6;1-2/h1-2,6-8,13H,3-5H2;1H3 |
| InChIKey | SXRUGJLRSLXBGQ-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.75 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|