C19H30O2 — CID 124761540
[(1R,3S)-3-[(1R,2R,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]cyclohexyl] prop-2-enoate (PubChem CID 124761540) has the molecular formula C19H30O2 and a molecular weight of 290.45 g/mol. Its IUPAC name is [(1R,3S)-3-[(1R,2R,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]cyclohexyl] prop-2-enoate.
| Compound Name | [(1R,3S)-3-[(1R,2R,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]cyclohexyl] prop-2-enoate |
|---|---|
| PubChem CID | 124761540 |
| Molecular Formula | C19H30O2 |
| Molecular Weight | 290.45 g/mol |
| Exact Mass | 290.22 |
| IUPAC Name | [(1R,3S)-3-[(1R,2R,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]cyclohexyl] prop-2-enoate |
| SMILES | C=CC(=O)O[C@@H]1CCC[C@H]([C@H]2C[C@H]3CC[C@@]2(C)C3(C)C)C1 |
| InChI | InChI=1S/C19H30O2/c1-5-17(20)21-15-8-6-7-13(11-15)16-12-14-9-10-19(16,4)18(14,2)3/h5,13-16H,1,6-12H2,2-4H3/t13-,14+,15+,16+,19+/m0/s1 |
| InChIKey | ZFPQUNUXAJOJHO-YAFCLFEMSA-N |
| XLogP | 4.74 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.45 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|