C20H32O2 — CID 166687996
[3-[(1R,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]cyclohexyl] 2-methylprop-2-enoate (PubChem CID 166687996) has the molecular formula C20H32O2 and a molecular weight of 304.47 g/mol. Its IUPAC name is [3-[(1R,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]cyclohexyl] 2-methylprop-2-enoate.
| Compound Name | [3-[(1R,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]cyclohexyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 166687996 |
| Molecular Formula | C20H32O2 |
| Molecular Weight | 304.47 g/mol |
| Exact Mass | 304.24 |
| IUPAC Name | [3-[(1R,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]cyclohexyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC1CCCC(C2C[C@H]3CC[C@@]2(C)C3(C)C)C1 |
| InChI | InChI=1S/C20H32O2/c1-13(2)18(21)22-16-8-6-7-14(11-16)17-12-15-9-10-20(17,5)19(15,3)4/h14-17H,1,6-12H2,2-5H3/t14?,15-,16?,17?,20-/m1/s1 |
| InChIKey | XMTPXNXBFPWTMG-RUVOVONGSA-N |
| XLogP | 5.13 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.47 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|