C18H30O3 — CID 139800990
[2,2-dimethyl-1-[(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)oxy]propyl] prop-2-enoate (PubChem CID 139800990) has the molecular formula C18H30O3 and a molecular weight of 294.44 g/mol. Its IUPAC name is [2,2-dimethyl-1-[(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)oxy]propyl] prop-2-enoate.
| Compound Name | [2,2-dimethyl-1-[(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)oxy]propyl] prop-2-enoate |
|---|---|
| PubChem CID | 139800990 |
| Molecular Formula | C18H30O3 |
| Molecular Weight | 294.44 g/mol |
| Exact Mass | 294.22 |
| IUPAC Name | [2,2-dimethyl-1-[(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)oxy]propyl] prop-2-enoate |
| SMILES | C=CC(=O)OC(OC1CC2CCC1(C)C2(C)C)C(C)(C)C |
| InChI | InChI=1S/C18H30O3/c1-8-14(19)21-15(16(2,3)4)20-13-11-12-9-10-18(13,7)17(12,5)6/h8,12-13,15H,1,9-11H2,2-7H3 |
| InChIKey | GSWHOAOUFQJKQE-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.44 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|