C16H26O3 — CID 66951278
2-methyl-4-[(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)oxy]pent-2-enoic acid (PubChem CID 66951278) has the molecular formula C16H26O3 and a molecular weight of 266.38 g/mol. Its IUPAC name is 2-methyl-4-[(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)oxy]pent-2-enoic acid.
| Compound Name | 2-methyl-4-[(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)oxy]pent-2-enoic acid |
|---|---|
| PubChem CID | 66951278 |
| Molecular Formula | C16H26O3 |
| Molecular Weight | 266.38 g/mol |
| Exact Mass | 266.19 |
| IUPAC Name | 2-methyl-4-[(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)oxy]pent-2-enoic acid |
| SMILES | CC(=CC(C)OC1CC2CCC1(C)C2(C)C)C(=O)O |
| InChI | InChI=1S/C16H26O3/c1-10(14(17)18)8-11(2)19-13-9-12-6-7-16(13,5)15(12,3)4/h8,11-13H,6-7,9H2,1-5H3,(H,17,18) |
| InChIKey | IHPNZPXDRHRPFB-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.38 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|