C14H24O — CID 70123120
2-but-3-en-2-yloxy-1,7,7-trimethylbicyclo[2.2.1]heptane (PubChem CID 70123120) has the molecular formula C14H24O and a molecular weight of 208.34 g/mol. Its IUPAC name is 2-but-3-en-2-yloxy-1,7,7-trimethylbicyclo[2.2.1]heptane.
| Compound Name | 2-but-3-en-2-yloxy-1,7,7-trimethylbicyclo[2.2.1]heptane |
|---|---|
| PubChem CID | 70123120 |
| Molecular Formula | C14H24O |
| Molecular Weight | 208.34 g/mol |
| Exact Mass | 208.18 |
| IUPAC Name | 2-but-3-en-2-yloxy-1,7,7-trimethylbicyclo[2.2.1]heptane |
| SMILES | C=CC(C)OC1CC2CCC1(C)C2(C)C |
| InChI | InChI=1S/C14H24O/c1-6-10(2)15-12-9-11-7-8-14(12,5)13(11,3)4/h6,10-12H,1,7-9H2,2-5H3 |
| InChIKey | VFIGKOWMHCNPJF-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.34 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|