C15H32OSi2 — CID 554472
dimethyl-[(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)oxy]-trimethylsilylsilane (PubChem CID 554472) has the molecular formula C15H32OSi2 and a molecular weight of 284.59 g/mol. Its IUPAC name is dimethyl-[(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)oxy]-trimethylsilylsilane.
| Compound Name | dimethyl-[(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)oxy]-trimethylsilylsilane |
|---|---|
| PubChem CID | 554472 |
| Molecular Formula | C15H32OSi2 |
| Molecular Weight | 284.59 g/mol |
| Exact Mass | 284.20 |
| IUPAC Name | dimethyl-[(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)oxy]-trimethylsilylsilane |
| SMILES | CC1(C)C2CCC1(C)C(O[Si](C)(C)[Si](C)(C)C)C2 |
| InChI | InChI=1S/C15H32OSi2/c1-14(2)12-9-10-15(14,3)13(11-12)16-18(7,8)17(4,5)6/h12-13H,9-11H2,1-8H3 |
| InChIKey | MJSGKSOAYQWXBA-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.59 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|