C22H40O3Si — CID 57356787
methoxymethyl-bis[(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)oxy]silane (PubChem CID 57356787) has the molecular formula C22H40O3Si and a molecular weight of 380.65 g/mol. Its IUPAC name is methoxymethyl-bis[(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)oxy]silane.
| Compound Name | methoxymethyl-bis[(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)oxy]silane |
|---|---|
| PubChem CID | 57356787 |
| Molecular Formula | C22H40O3Si |
| Molecular Weight | 380.65 g/mol |
| Exact Mass | 380.27 |
| IUPAC Name | methoxymethyl-bis[(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)oxy]silane |
| SMILES | COC[SiH](OC1CC2CCC1(C)C2(C)C)OC1CC2CCC1(C)C2(C)C |
| InChI | InChI=1S/C22H40O3Si/c1-19(2)15-8-10-21(19,5)17(12-15)24-26(14-23-7)25-18-13-16-9-11-22(18,6)20(16,3)4/h15-18,26H,8-14H2,1-7H3 |
| InChIKey | CDDPPEGVOOEXFG-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.65 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|