C21H30O6 — CID 174847929
(3-methoxy-3-oxoprop-1-en-2-yl) 2-methylprop-2-enoate;[(1S,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] prop-2-enoate (PubChem CID 174847929) has the molecular formula C21H30O6 and a molecular weight of 378.47 g/mol. Its IUPAC name is (3-methoxy-3-oxoprop-1-en-2-yl) 2-methylprop-2-enoate;[(1S,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] prop-2-enoate.
| Compound Name | (3-methoxy-3-oxoprop-1-en-2-yl) 2-methylprop-2-enoate;[(1S,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] prop-2-enoate |
|---|---|
| PubChem CID | 174847929 |
| Molecular Formula | C21H30O6 |
| Molecular Weight | 378.47 g/mol |
| Exact Mass | 378.20 |
| IUPAC Name | (3-methoxy-3-oxoprop-1-en-2-yl) 2-methylprop-2-enoate;[(1S,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] prop-2-enoate |
| SMILES | C=C(C)C(=O)OC(=C)C(=O)OC.C=CC(=O)OC1C[C@H]2CC[C@@]1(C)C2(C)C |
| InChI | InChI=1S/C13H20O2.C8H10O4/c1-5-11(14)15-10-8-9-6-7-13(10,4)12(9,2)3;1-5(2)7(9)12-6(3)8(10)11-4/h5,9-10H,1,6-8H2,2-4H3;1,3H2,2,4H3/t9-,10?,13-;/m1./s1 |
| InChIKey | ORMGTROMDJULHI-BYUSNUGWSA-N |
| XLogP | 3.72 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.47 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|