C14H20N4O8 — CID 5205680
7,7-dinitro-6-[1-(1-nitrocyclobutyl)cyclobutyl]oxy-5-oxa-6-azaspiro[3.4]octane (PubChem CID 5205680) has the molecular formula C14H20N4O8 and a molecular weight of 372.33 g/mol. Its IUPAC name is 7,7-dinitro-6-[1-(1-nitrocyclobutyl)cyclobutyl]oxy-5-oxa-6-azaspiro[3.4]octane.
| Compound Name | 7,7-dinitro-6-[1-(1-nitrocyclobutyl)cyclobutyl]oxy-5-oxa-6-azaspiro[3.4]octane |
|---|---|
| PubChem CID | 5205680 |
| Molecular Formula | C14H20N4O8 |
| Molecular Weight | 372.33 g/mol |
| Exact Mass | 372.13 |
| IUPAC Name | 7,7-dinitro-6-[1-(1-nitrocyclobutyl)cyclobutyl]oxy-5-oxa-6-azaspiro[3.4]octane |
| SMILES | O=[N+]([O-])C1([N+](=O)[O-])CC2(CCC2)ON1OC1(C2([N+](=O)[O-])CCC2)CCC1 |
| InChI | InChI=1S/C14H20N4O8/c19-15(20)12(6-2-7-12)13(8-3-9-13)26-18-14(16(21)22,17(23)24)10-11(25-18)4-1-5-11/h1-10H2 |
| InChIKey | XMDDHEVMTXIBRH-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 151.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.33 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|