C13H20N2O4 — CID 134925154
(1S,3aS,6aR)-1-methyl-2-morpholin-4-yl-6a-nitro-3a,4,5,6-tetrahydropentalen-1-ol (PubChem CID 134925154) has the molecular formula C13H20N2O4 and a molecular weight of 268.31 g/mol. Its IUPAC name is (1S,3aS,6aR)-1-methyl-2-morpholin-4-yl-6a-nitro-3a,4,5,6-tetrahydropentalen-1-ol.
| Compound Name | (1S,3aS,6aR)-1-methyl-2-morpholin-4-yl-6a-nitro-3a,4,5,6-tetrahydropentalen-1-ol |
|---|---|
| PubChem CID | 134925154 |
| Molecular Formula | C13H20N2O4 |
| Molecular Weight | 268.31 g/mol |
| Exact Mass | 268.14 |
| IUPAC Name | (1S,3aS,6aR)-1-methyl-2-morpholin-4-yl-6a-nitro-3a,4,5,6-tetrahydropentalen-1-ol |
| SMILES | C[C@]1(O)C(N2CCOCC2)=C[C@@H]2CCC[C@@]21[N+](=O)[O-] |
| InChI | InChI=1S/C13H20N2O4/c1-12(16)11(14-5-7-19-8-6-14)9-10-3-2-4-13(10,12)15(17)18/h9-10,16H,2-8H2,1H3/t10-,12-,13+/m0/s1 |
| InChIKey | JBVKCLJWZFANRE-WCFLWFBJSA-N |
| XLogP | 0.78 |
| TPSA | 75.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.31 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|