C24H37NO2 — CID 67245932
(8S,9S,10R,13S,14S)-7,10,13-trimethyl-17-morpholin-4-yl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-1-ol (PubChem CID 67245932) has the molecular formula C24H37NO2 and a molecular weight of 371.57 g/mol. Its IUPAC name is (8S,9S,10R,13S,14S)-7,10,13-trimethyl-17-morpholin-4-yl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-1-ol.
| Compound Name | (8S,9S,10R,13S,14S)-7,10,13-trimethyl-17-morpholin-4-yl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-1-ol |
|---|---|
| PubChem CID | 67245932 |
| Molecular Formula | C24H37NO2 |
| Molecular Weight | 371.57 g/mol |
| Exact Mass | 371.28 |
| IUPAC Name | (8S,9S,10R,13S,14S)-7,10,13-trimethyl-17-morpholin-4-yl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-1-ol |
| SMILES | CC1C=C2CCCC(O)[C@]2(C)[C@H]2CC[C@]3(C)C(N4CCOCC4)=CC[C@H]3[C@H]12 |
| InChI | InChI=1S/C24H37NO2/c1-16-15-17-5-4-6-21(26)24(17,3)19-9-10-23(2)18(22(16)19)7-8-20(23)25-11-13-27-14-12-25/h8,15-16,18-19,21-22,26H,4-7,9-14H2,1-3H3/t16?,18-,19-,21?,22-,23-,24-/m0/s1 |
| InChIKey | XJFHCHUMVFTLTF-FIUZLJGUSA-N |
| XLogP | 4.38 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.57 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|