C15H19N3O3 — CID 64970576
3-methyl-1-(4-morpholin-4-ylphenyl)piperazine-2,5-dione (PubChem CID 64970576) has the molecular formula C15H19N3O3 and a molecular weight of 289.34 g/mol. Its IUPAC name is 3-methyl-1-(4-morpholin-4-ylphenyl)piperazine-2,5-dione.
| Compound Name | 3-methyl-1-(4-morpholin-4-ylphenyl)piperazine-2,5-dione |
|---|---|
| PubChem CID | 64970576 |
| Molecular Formula | C15H19N3O3 |
| Molecular Weight | 289.34 g/mol |
| Exact Mass | 289.14 |
| IUPAC Name | 3-methyl-1-(4-morpholin-4-ylphenyl)piperazine-2,5-dione |
| SMILES | CC1NC(=O)CN(c2ccc(N3CCOCC3)cc2)C1=O |
| InChI | InChI=1S/C15H19N3O3/c1-11-15(20)18(10-14(19)16-11)13-4-2-12(3-5-13)17-6-8-21-9-7-17/h2-5,11H,6-10H2,1H3,(H,16,19) |
| InChIKey | DCAWMVMDVSZZQJ-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.34 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|