C15H19N3O3 — CID 69342956
5,5-dimethyl-3-(4-morpholin-4-ylphenyl)imidazolidine-2,4-dione (PubChem CID 69342956) has the molecular formula C15H19N3O3 and a molecular weight of 289.33 g/mol. Its IUPAC name is 5,5-dimethyl-3-(4-morpholin-4-ylphenyl)imidazolidine-2,4-dione.
| Compound Name | 5,5-dimethyl-3-(4-morpholin-4-ylphenyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 69342956 |
| Molecular Formula | C15H19N3O3 |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.14 |
| IUPAC Name | 5,5-dimethyl-3-(4-morpholin-4-ylphenyl)imidazolidine-2,4-dione |
| SMILES | CC1(C)NC(=O)N(c2ccc(N3CCOCC3)cc2)C1=O |
| InChI | InChI=1S/C15H19N3O3/c1-15(2)13(19)18(14(20)16-15)12-5-3-11(4-6-12)17-7-9-21-10-8-17/h3-6H,7-10H2,1-2H3,(H,16,20) |
| InChIKey | XJULTLQAPVFVJN-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|