C23H31NOS — CID 67225877
(3S,7R,8R,9S,10R,13S,14S)-7,10,13-trimethyl-17-(1,3-thiazol-2-yl)-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-ol (PubChem CID 67225877) has the molecular formula C23H31NOS and a molecular weight of 369.57 g/mol. Its IUPAC name is (3S,7R,8R,9S,10R,13S,14S)-7,10,13-trimethyl-17-(1,3-thiazol-2-yl)-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-ol.
| Compound Name | (3S,7R,8R,9S,10R,13S,14S)-7,10,13-trimethyl-17-(1,3-thiazol-2-yl)-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 67225877 |
| Molecular Formula | C23H31NOS |
| Molecular Weight | 369.57 g/mol |
| Exact Mass | 369.21 |
| IUPAC Name | (3S,7R,8R,9S,10R,13S,14S)-7,10,13-trimethyl-17-(1,3-thiazol-2-yl)-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-ol |
| SMILES | C[C@H]1C=C2C[C@@H](O)CC[C@]2(C)[C@H]2CC[C@]3(C)C(c4nccs4)=CC[C@H]3[C@H]12 |
| InChI | InChI=1S/C23H31NOS/c1-14-12-15-13-16(25)6-8-22(15,2)18-7-9-23(3)17(20(14)18)4-5-19(23)21-24-10-11-26-21/h5,10-12,14,16-18,20,25H,4,6-9,13H2,1-3H3/t14-,16-,17-,18-,20-,22-,23-/m0/s1 |
| InChIKey | RTIQTXPGZNAVQQ-LFOOWCSXSA-N |
| XLogP | 5.71 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.57 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|