C28H39NO — CID 67224912
(8R,9R,10R,13S,14S)-7-butyl-10,13-dimethyl-17-pyridin-3-yl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-ol (PubChem CID 67224912) has the molecular formula C28H39NO and a molecular weight of 405.63 g/mol. Its IUPAC name is (8R,9R,10R,13S,14S)-7-butyl-10,13-dimethyl-17-pyridin-3-yl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-ol.
| Compound Name | (8R,9R,10R,13S,14S)-7-butyl-10,13-dimethyl-17-pyridin-3-yl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 67224912 |
| Molecular Formula | C28H39NO |
| Molecular Weight | 405.63 g/mol |
| Exact Mass | 405.30 |
| IUPAC Name | (8R,9R,10R,13S,14S)-7-butyl-10,13-dimethyl-17-pyridin-3-yl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-ol |
| SMILES | CCCCC1C=C2CC(O)CC[C@]2(C)[C@@H]2CC[C@]3(C)C(c4cccnc4)=CC[C@H]3[C@H]12 |
| InChI | InChI=1S/C28H39NO/c1-4-5-7-19-16-21-17-22(30)11-13-27(21,2)25-12-14-28(3)23(9-10-24(28)26(19)25)20-8-6-15-29-18-20/h6,8-9,15-16,18-19,22,24-26,30H,4-5,7,10-14,17H2,1-3H3/t19?,22?,24-,25+,26-,27-,28+/m0/s1 |
| InChIKey | DNTKWTZATOXQQN-PLSKYGETSA-N |
| XLogP | 6.81 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.63 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|