C34H51NO3 — CID 155089200
decanoic acid;(3S,8R,9S,10R,13S,14S)-10,13-dimethyl-17-pyridin-3-yl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-ol (PubChem CID 155089200) has the molecular formula C34H51NO3 and a molecular weight of 521.79 g/mol. Its IUPAC name is decanoic acid;(3S,8R,9S,10R,13S,14S)-10,13-dimethyl-17-pyridin-3-yl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-ol.
| Compound Name | decanoic acid;(3S,8R,9S,10R,13S,14S)-10,13-dimethyl-17-pyridin-3-yl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 155089200 |
| Molecular Formula | C34H51NO3 |
| Molecular Weight | 521.79 g/mol |
| Exact Mass | 521.39 |
| IUPAC Name | decanoic acid;(3S,8R,9S,10R,13S,14S)-10,13-dimethyl-17-pyridin-3-yl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-ol |
| SMILES | CCCCCCCCCC(=O)O.C[C@]12CC[C@H](O)CC1=CC[C@@H]1[C@@H]2CC[C@]2(C)C(c3cccnc3)=CC[C@@H]12 |
| InChI | InChI=1S/C24H31NO.C10H20O2/c1-23-11-9-18(26)14-17(23)5-6-19-21-8-7-20(16-4-3-13-25-15-16)24(21,2)12-10-22(19)23;1-2-3-4-5-6-7-8-9-10(11)12/h3-5,7,13,15,18-19,21-22,26H,6,8-12,14H2,1-2H3;2-9H2,1H3,(H,11,12)/t18-,19-,21-,22-,23-,24+;/m0./s1 |
| InChIKey | FCLWZYIZJQXMML-HXYAFLPDSA-N |
| XLogP | 8.61 |
| TPSA | 70.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.79 |
| LogP ≤ 5 | 8.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|