C29H40N2O2 — CID 76902363
[(3S,8R,9S,10R,13S,14S)-10,13-dimethyl-17-pyridin-3-yl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-yl] N,N-diethylcarbamate (PubChem CID 76902363) has the molecular formula C29H40N2O2 and a molecular weight of 448.65 g/mol. Its IUPAC name is [(3S,8R,9S,10R,13S,14S)-10,13-dimethyl-17-pyridin-3-yl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-yl] N,N-diethylcarbamate.
| Compound Name | [(3S,8R,9S,10R,13S,14S)-10,13-dimethyl-17-pyridin-3-yl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-yl] N,N-diethylcarbamate |
|---|---|
| PubChem CID | 76902363 |
| Molecular Formula | C29H40N2O2 |
| Molecular Weight | 448.65 g/mol |
| Exact Mass | 448.31 |
| IUPAC Name | [(3S,8R,9S,10R,13S,14S)-10,13-dimethyl-17-pyridin-3-yl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-yl] N,N-diethylcarbamate |
| SMILES | CCN(CC)C(=O)O[C@H]1CC[C@@]2(C)C(=CC[C@@H]3[C@@H]2CC[C@]2(C)C(c4cccnc4)=CC[C@@H]32)C1 |
| InChI | InChI=1S/C29H40N2O2/c1-5-31(6-2)27(32)33-22-13-15-28(3)21(18-22)9-10-23-25-12-11-24(20-8-7-17-30-19-20)29(25,4)16-14-26(23)28/h7-9,11,17,19,22-23,25-26H,5-6,10,12-16,18H2,1-4H3/t22-,23-,25-,26-,28-,29+/m0/s1 |
| InChIKey | IMLMQZQNHPKRGQ-YVBNVJAJSA-N |
| XLogP | 6.88 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.65 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|