C29H39NO4 — CID 174790043
[(3S,8R,9S,10R,13S,14S)-10,13-dimethyl-17-pyridin-3-yl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-yl] 2-ethoxyethyl carbonate (PubChem CID 174790043) has the molecular formula C29H39NO4 and a molecular weight of 465.63 g/mol. Its IUPAC name is [(3S,8R,9S,10R,13S,14S)-10,13-dimethyl-17-pyridin-3-yl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-yl] 2-ethoxyethyl carbonate.
| Compound Name | [(3S,8R,9S,10R,13S,14S)-10,13-dimethyl-17-pyridin-3-yl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-yl] 2-ethoxyethyl carbonate |
|---|---|
| PubChem CID | 174790043 |
| Molecular Formula | C29H39NO4 |
| Molecular Weight | 465.63 g/mol |
| Exact Mass | 465.29 |
| IUPAC Name | [(3S,8R,9S,10R,13S,14S)-10,13-dimethyl-17-pyridin-3-yl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-yl] 2-ethoxyethyl carbonate |
| SMILES | CCOCCOC(=O)O[C@H]1CC[C@@]2(C)C(=CC[C@@H]3[C@@H]2CC[C@]2(C)C(c4cccnc4)=CC[C@@H]32)C1 |
| InChI | InChI=1S/C29H39NO4/c1-4-32-16-17-33-27(31)34-22-11-13-28(2)21(18-22)7-8-23-25-10-9-24(20-6-5-15-30-19-20)29(25,3)14-12-26(23)28/h5-7,9,15,19,22-23,25-26H,4,8,10-14,16-18H2,1-3H3/t22-,23-,25-,26-,28-,29+/m0/s1 |
| InChIKey | VCFIRVBGMHKYKK-YVBNVJAJSA-N |
| XLogP | 6.60 |
| TPSA | 57.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.63 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|