C32H43NO5 — CID 174790141
(2,2-dimethyl-1,3-dioxan-5-yl)methyl [(3S,8R,9S,10R,13S,14S)-10,13-dimethyl-17-pyridin-3-yl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-yl] carbonate (PubChem CID 174790141) has the molecular formula C32H43NO5 and a molecular weight of 521.70 g/mol. Its IUPAC name is (2,2-dimethyl-1,3-dioxan-5-yl)methyl [(3S,8R,9S,10R,13S,14S)-10,13-dimethyl-17-pyridin-3-yl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-yl] carbonate.
| Compound Name | (2,2-dimethyl-1,3-dioxan-5-yl)methyl [(3S,8R,9S,10R,13S,14S)-10,13-dimethyl-17-pyridin-3-yl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-yl] carbonate |
|---|---|
| PubChem CID | 174790141 |
| Molecular Formula | C32H43NO5 |
| Molecular Weight | 521.70 g/mol |
| Exact Mass | 521.31 |
| IUPAC Name | (2,2-dimethyl-1,3-dioxan-5-yl)methyl [(3S,8R,9S,10R,13S,14S)-10,13-dimethyl-17-pyridin-3-yl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-yl] carbonate |
| SMILES | CC1(C)OCC(COC(=O)O[C@H]2CC[C@@]3(C)C(=CC[C@@H]4[C@@H]3CC[C@]3(C)C(c5cccnc5)=CC[C@@H]43)C2)CO1 |
| InChI | InChI=1S/C32H43NO5/c1-30(2)36-19-21(20-37-30)18-35-29(34)38-24-11-13-31(3)23(16-24)7-8-25-27-10-9-26(22-6-5-15-33-17-22)32(27,4)14-12-28(25)31/h5-7,9,15,17,21,24-25,27-28H,8,10-14,16,18-20H2,1-4H3/t24-,25-,27-,28-,31-,32+/m0/s1 |
| InChIKey | RXJAQOMICNJSPP-RMAZQVEGSA-N |
| XLogP | 6.96 |
| TPSA | 66.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.70 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|