C27H35NO7P-3 — CID 86293991
[(10R,13S)-10,13-dimethyl-17-pyridin-3-yl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-yl] ethyl carbonate phosphate (PubChem CID 86293991) has the molecular formula C27H35NO7P-3 and a molecular weight of 516.55 g/mol. Its IUPAC name is [(10R,13S)-10,13-dimethyl-17-pyridin-3-yl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-yl] ethyl carbonate phosphate.
| Compound Name | [(10R,13S)-10,13-dimethyl-17-pyridin-3-yl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-yl] ethyl carbonate phosphate |
|---|---|
| PubChem CID | 86293991 |
| Molecular Formula | C27H35NO7P-3 |
| Molecular Weight | 516.55 g/mol |
| Exact Mass | 516.22 |
| IUPAC Name | [(10R,13S)-10,13-dimethyl-17-pyridin-3-yl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-yl] ethyl carbonate phosphate |
| SMILES | CCOC(=O)OC1CC[C@@]2(C)C(=CCC3C2CC[C@]2(C)C(c4cccnc4)=CCC32)C1.O=P([O-])([O-])[O-] |
| InChI | InChI=1S/C27H35NO3.H3O4P/c1-4-30-25(29)31-20-11-13-26(2)19(16-20)7-8-21-23-10-9-22(18-6-5-15-28-17-18)27(23,3)14-12-24(21)26;1-5(2,3)4/h5-7,9,15,17,20-21,23-24H,4,8,10-14,16H2,1-3H3;(H3,1,2,3,4)/p-3/t20?,21?,23?,24?,26-,27+;/m0./s1 |
| InChIKey | PUJKCGILIFFCSL-IAWIITSTSA-K |
| XLogP | 3.75 |
| TPSA | 134.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.55 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|