C27H35NO7S-2 — CID 86293617
[(10R,13S)-10,13-dimethyl-17-pyridin-3-yl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-yl] ethyl carbonate sulfate (PubChem CID 86293617) has the molecular formula C27H35NO7S-2 and a molecular weight of 517.64 g/mol. Its IUPAC name is [(10R,13S)-10,13-dimethyl-17-pyridin-3-yl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-yl] ethyl carbonate sulfate.
| Compound Name | [(10R,13S)-10,13-dimethyl-17-pyridin-3-yl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-yl] ethyl carbonate sulfate |
|---|---|
| PubChem CID | 86293617 |
| Molecular Formula | C27H35NO7S-2 |
| Molecular Weight | 517.64 g/mol |
| Exact Mass | 517.21 |
| IUPAC Name | [(10R,13S)-10,13-dimethyl-17-pyridin-3-yl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-yl] ethyl carbonate sulfate |
| SMILES | CCOC(=O)OC1CC[C@@]2(C)C(=CCC3C2CC[C@]2(C)C(c4cccnc4)=CCC32)C1.O=S(=O)([O-])[O-] |
| InChI | InChI=1S/C27H35NO3.H2O4S/c1-4-30-25(29)31-20-11-13-26(2)19(16-20)7-8-21-23-10-9-22(18-6-5-15-28-17-18)27(23,3)14-12-24(21)26;1-5(2,3)4/h5-7,9,15,17,20-21,23-24H,4,8,10-14,16H2,1-3H3;(H2,1,2,3,4)/p-2/t20?,21?,23?,24?,26-,27+;/m0./s1 |
| InChIKey | OMKSLUJLMGHRNW-IAWIITSTSA-L |
| XLogP | 5.24 |
| TPSA | 128.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.64 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|