C28H37N3O3 — CID 76902935
[(3S,8R,9S,10R,13S,14S)-10,13-dimethyl-17-pyridin-3-yl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-yl] 2,4-diamino-4-oxobutanoate (PubChem CID 76902935) has the molecular formula C28H37N3O3 and a molecular weight of 463.62 g/mol. Its IUPAC name is [(3S,8R,9S,10R,13S,14S)-10,13-dimethyl-17-pyridin-3-yl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-yl] 2,4-diamino-4-oxobutanoate.
| Compound Name | [(3S,8R,9S,10R,13S,14S)-10,13-dimethyl-17-pyridin-3-yl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-yl] 2,4-diamino-4-oxobutanoate |
|---|---|
| PubChem CID | 76902935 |
| Molecular Formula | C28H37N3O3 |
| Molecular Weight | 463.62 g/mol |
| Exact Mass | 463.28 |
| IUPAC Name | [(3S,8R,9S,10R,13S,14S)-10,13-dimethyl-17-pyridin-3-yl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-yl] 2,4-diamino-4-oxobutanoate |
| SMILES | C[C@]12CC[C@H](OC(=O)C(N)CC(N)=O)CC1=CC[C@@H]1[C@@H]2CC[C@]2(C)C(c3cccnc3)=CC[C@@H]12 |
| InChI | InChI=1S/C28H37N3O3/c1-27-11-9-19(34-26(33)24(29)15-25(30)32)14-18(27)5-6-20-22-8-7-21(17-4-3-13-31-16-17)28(22,2)12-10-23(20)27/h3-5,7,13,16,19-20,22-24H,6,8-12,14-15,29H2,1-2H3,(H2,30,32)/t19-,20-,22-,23-,24?,27-,28+/m0/s1 |
| InChIKey | CTZJVRKVZNXPLH-XZFSTPNXSA-N |
| XLogP | 4.15 |
| TPSA | 108.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.62 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|