C32H47N2O2+ — CID 91502803
[2-[(10,13-dimethyl-17-pyridin-3-yl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-yl)oxy]-2-oxoethyl]-triethylazanium (PubChem CID 91502803) has the molecular formula C32H47N2O2+ and a molecular weight of 491.74 g/mol. Its IUPAC name is [2-[(10,13-dimethyl-17-pyridin-3-yl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-yl)oxy]-2-oxoethyl]-triethylazanium.
| Compound Name | [2-[(10,13-dimethyl-17-pyridin-3-yl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-yl)oxy]-2-oxoethyl]-triethylazanium |
|---|---|
| PubChem CID | 91502803 |
| Molecular Formula | C32H47N2O2+ |
| Molecular Weight | 491.74 g/mol |
| Exact Mass | 491.36 |
| IUPAC Name | [2-[(10,13-dimethyl-17-pyridin-3-yl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-yl)oxy]-2-oxoethyl]-triethylazanium |
| SMILES | CC[N+](CC)(CC)CC(=O)OC1CCC2(C)C(=CCC3C2CCC2(C)C(c4cccnc4)=CCC32)C1 |
| InChI | InChI=1S/C32H47N2O2/c1-6-34(7-2,8-3)22-30(35)36-25-15-17-31(4)24(20-25)11-12-26-28-14-13-27(23-10-9-19-33-21-23)32(28,5)18-16-29(26)31/h9-11,13,19,21,25-26,28-29H,6-8,12,14-18,20,22H2,1-5H3/q+1 |
| InChIKey | FSARIXBTIDBMRE-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.74 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|