C26H34N2O2 — CID 118523815
(10,13-dimethyl-17-pyridin-3-yl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-yl) 2-aminoacetate (PubChem CID 118523815) has the molecular formula C26H34N2O2 and a molecular weight of 406.57 g/mol. Its IUPAC name is (10,13-dimethyl-17-pyridin-3-yl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-yl) 2-aminoacetate.
| Compound Name | (10,13-dimethyl-17-pyridin-3-yl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-yl) 2-aminoacetate |
|---|---|
| PubChem CID | 118523815 |
| Molecular Formula | C26H34N2O2 |
| Molecular Weight | 406.57 g/mol |
| Exact Mass | 406.26 |
| IUPAC Name | (10,13-dimethyl-17-pyridin-3-yl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-yl) 2-aminoacetate |
| SMILES | CC12CCC(OC(=O)CN)CC1=CCC1C2CCC2(C)C(c3cccnc3)=CCC12 |
| InChI | InChI=1S/C26H34N2O2/c1-25-11-9-19(30-24(29)15-27)14-18(25)5-6-20-22-8-7-21(17-4-3-13-28-16-17)26(22,2)12-10-23(20)25/h3-5,7,13,16,19-20,22-23H,6,8-12,14-15,27H2,1-2H3 |
| InChIKey | SQNBNHLSBALCII-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.57 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|