C27H36N2O2S — CID 118523852
[(3S,8R,9S,10R,13S,14S)-10,13-dimethyl-17-pyridin-3-yl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-yl] (2R)-2-amino-3-sulfanylpropanoate (PubChem CID 118523852) has the molecular formula C27H36N2O2S and a molecular weight of 452.66 g/mol. Its IUPAC name is [(3S,8R,9S,10R,13S,14S)-10,13-dimethyl-17-pyridin-3-yl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-yl] (2R)-2-amino-3-sulfanylpropanoate.
| Compound Name | [(3S,8R,9S,10R,13S,14S)-10,13-dimethyl-17-pyridin-3-yl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-yl] (2R)-2-amino-3-sulfanylpropanoate |
|---|---|
| PubChem CID | 118523852 |
| Molecular Formula | C27H36N2O2S |
| Molecular Weight | 452.66 g/mol |
| Exact Mass | 452.25 |
| IUPAC Name | [(3S,8R,9S,10R,13S,14S)-10,13-dimethyl-17-pyridin-3-yl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-yl] (2R)-2-amino-3-sulfanylpropanoate |
| SMILES | C[C@]12CC[C@H](OC(=O)[C@@H](N)CS)CC1=CC[C@@H]1[C@@H]2CC[C@]2(C)C(c3cccnc3)=CC[C@@H]12 |
| InChI | InChI=1S/C27H36N2O2S/c1-26-11-9-19(31-25(30)24(28)16-32)14-18(26)5-6-20-22-8-7-21(17-4-3-13-29-15-17)27(22,2)12-10-23(20)26/h3-5,7,13,15,19-20,22-24,32H,6,8-12,14,16,28H2,1-2H3/t19-,20-,22-,23-,24-,26-,27+/m0/s1 |
| InChIKey | DKHSAJYWHCYKDO-PGPYRLFKSA-N |
| XLogP | 5.21 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.66 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|