C27H34ClNO3 — CID 174790052
1-chloroethyl [(3S,8R,9S,10R,13S,14S)-10,13-dimethyl-17-pyridin-3-yl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-yl] carbonate (PubChem CID 174790052) has the molecular formula C27H34ClNO3 and a molecular weight of 456.03 g/mol. Its IUPAC name is 1-chloroethyl [(3S,8R,9S,10R,13S,14S)-10,13-dimethyl-17-pyridin-3-yl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-yl] carbonate.
| Compound Name | 1-chloroethyl [(3S,8R,9S,10R,13S,14S)-10,13-dimethyl-17-pyridin-3-yl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-yl] carbonate |
|---|---|
| PubChem CID | 174790052 |
| Molecular Formula | C27H34ClNO3 |
| Molecular Weight | 456.03 g/mol |
| Exact Mass | 455.22 |
| IUPAC Name | 1-chloroethyl [(3S,8R,9S,10R,13S,14S)-10,13-dimethyl-17-pyridin-3-yl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-yl] carbonate |
| SMILES | CC(Cl)OC(=O)O[C@H]1CC[C@@]2(C)C(=CC[C@@H]3[C@@H]2CC[C@]2(C)C(c4cccnc4)=CC[C@@H]32)C1 |
| InChI | InChI=1S/C27H34ClNO3/c1-17(28)31-25(30)32-20-10-12-26(2)19(15-20)6-7-21-23-9-8-22(18-5-4-14-29-16-18)27(23,3)13-11-24(21)26/h4-6,8,14,16-17,20-21,23-24H,7,9-13,15H2,1-3H3/t17?,20-,21-,23-,24-,26-,27+/m0/s1 |
| InChIKey | QJLJKLWOVZSOHF-RYQVBJHRSA-N |
| XLogP | 7.14 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.03 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|