C31H35NO5 — CID 76830940
(10,13-dimethyl-17-pyridin-3-yl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-yl) 3,4,5-trihydroxybenzoate (PubChem CID 76830940) has the molecular formula C31H35NO5 and a molecular weight of 501.62 g/mol. Its IUPAC name is (10,13-dimethyl-17-pyridin-3-yl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-yl) 3,4,5-trihydroxybenzoate.
| Compound Name | (10,13-dimethyl-17-pyridin-3-yl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-yl) 3,4,5-trihydroxybenzoate |
|---|---|
| PubChem CID | 76830940 |
| Molecular Formula | C31H35NO5 |
| Molecular Weight | 501.62 g/mol |
| Exact Mass | 501.25 |
| IUPAC Name | (10,13-dimethyl-17-pyridin-3-yl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-yl) 3,4,5-trihydroxybenzoate |
| SMILES | CC12CCC(OC(=O)c3cc(O)c(O)c(O)c3)CC1=CCC1C2CCC2(C)C(c3cccnc3)=CCC12 |
| InChI | InChI=1S/C31H35NO5/c1-30-11-9-21(37-29(36)19-14-26(33)28(35)27(34)15-19)16-20(30)5-6-22-24-8-7-23(18-4-3-13-32-17-18)31(24,2)12-10-25(22)30/h3-5,7,13-15,17,21-22,24-25,33-35H,6,8-12,16H2,1-2H3 |
| InChIKey | PINNADVYQIAFRA-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 99.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.62 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|