C34H40N2O4 — CID 144987360
[2-(benzylamino)-2-oxoethyl] [(9S)-10,13-dimethyl-17-pyridin-3-yl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-yl] carbonate (PubChem CID 144987360) has the molecular formula C34H40N2O4 and a molecular weight of 540.70 g/mol. Its IUPAC name is [2-(benzylamino)-2-oxoethyl] [(9S)-10,13-dimethyl-17-pyridin-3-yl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-yl] carbonate.
| Compound Name | [2-(benzylamino)-2-oxoethyl] [(9S)-10,13-dimethyl-17-pyridin-3-yl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-yl] carbonate |
|---|---|
| PubChem CID | 144987360 |
| Molecular Formula | C34H40N2O4 |
| Molecular Weight | 540.70 g/mol |
| Exact Mass | 540.30 |
| IUPAC Name | [2-(benzylamino)-2-oxoethyl] [(9S)-10,13-dimethyl-17-pyridin-3-yl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-yl] carbonate |
| SMILES | CC12CC[C@H]3C(CC=C4CC(OC(=O)OCC(=O)NCc5ccccc5)CCC43C)C1CC=C2c1cccnc1 |
| InChI | InChI=1S/C34H40N2O4/c1-33-16-14-26(40-32(38)39-22-31(37)36-20-23-7-4-3-5-8-23)19-25(33)10-11-27-29-13-12-28(24-9-6-18-35-21-24)34(29,2)17-15-30(27)33/h3-10,12,18,21,26-27,29-30H,11,13-17,19-20,22H2,1-2H3,(H,36,37)/t26?,27?,29?,30-,33?,34?/m0/s1 |
| InChIKey | AJJXWCRGUNXIJC-KUUSLQTMSA-N |
| XLogP | 6.88 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.70 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|