C24H31NO — CID 140959437
(3S,10R,13S)-17-(6-deuterio-3-pyridinyl)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-ol (PubChem CID 140959437) has the molecular formula C24H31NO and a molecular weight of 350.52 g/mol. Its IUPAC name is (3S,10R,13S)-17-(6-deuterio-3-pyridinyl)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-ol.
| Compound Name | (3S,10R,13S)-17-(6-deuterio-3-pyridinyl)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 140959437 |
| Molecular Formula | C24H31NO |
| Molecular Weight | 350.52 g/mol |
| Exact Mass | 350.25 |
| IUPAC Name | (3S,10R,13S)-17-(6-deuterio-3-pyridinyl)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-ol |
| SMILES | [2H]c1ccc(C2=CCC3C4CC=C5C[C@@H](O)CC[C@]5(C)C4CC[C@]23C)cn1 |
| InChI | InChI=1S/C24H31NO/c1-23-11-9-18(26)14-17(23)5-6-19-21-8-7-20(16-4-3-13-25-15-16)24(21,2)12-10-22(19)23/h3-5,7,13,15,18-19,21-22,26H,6,8-12,14H2,1-2H3/t18-,19?,21?,22?,23-,24+/m0/s1/i13D |
| InChIKey | GZOSMCIZMLWJML-SCTWVKQRSA-N |
| XLogP | 5.40 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.52 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|