C30H43N — CID 171539051
3-[10,13-dimethyl-3-(2-methylprop-2-enyl)-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-17-yl]pyridine;ethane (PubChem CID 171539051) has the molecular formula C30H43N and a molecular weight of 417.68 g/mol. Its IUPAC name is 3-[10,13-dimethyl-3-(2-methylprop-2-enyl)-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-17-yl]pyridine;ethane.
| Compound Name | 3-[10,13-dimethyl-3-(2-methylprop-2-enyl)-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-17-yl]pyridine;ethane |
|---|---|
| PubChem CID | 171539051 |
| Molecular Formula | C30H43N |
| Molecular Weight | 417.68 g/mol |
| Exact Mass | 417.34 |
| IUPAC Name | 3-[10,13-dimethyl-3-(2-methylprop-2-enyl)-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-17-yl]pyridine;ethane |
| SMILES | C=C(C)CC1CCC2(C)C(=CCC3C2CCC2(C)C(c4cccnc4)=CCC32)C1.CC |
| InChI | InChI=1S/C28H37N.C2H6/c1-19(2)16-20-11-13-27(3)22(17-20)7-8-23-25-10-9-24(21-6-5-15-29-18-21)28(25,4)14-12-26(23)27;1-2/h5-7,9,15,18,20,23,25-26H,1,8,10-14,16-17H2,2-4H3;1-2H3 |
| InChIKey | FSORNDQAEZFJLC-UHFFFAOYSA-N |
| XLogP | 8.65 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.68 |
| LogP ≤ 5 | 8.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|