C24H30FNO — CID 77405402
17-(6-fluoro-3-pyridinyl)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-ol (PubChem CID 77405402) has the molecular formula C24H30FNO and a molecular weight of 367.51 g/mol. Its IUPAC name is 17-(6-fluoro-3-pyridinyl)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-ol.
| Compound Name | 17-(6-fluoro-3-pyridinyl)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 77405402 |
| Molecular Formula | C24H30FNO |
| Molecular Weight | 367.51 g/mol |
| Exact Mass | 367.23 |
| IUPAC Name | 17-(6-fluoro-3-pyridinyl)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-ol |
| SMILES | CC12CCC(O)CC1=CCC1C2CCC2(C)C(c3ccc(F)nc3)=CCC12 |
| InChI | InChI=1S/C24H30FNO/c1-23-11-9-17(27)13-16(23)4-5-18-20-7-6-19(15-3-8-22(25)26-14-15)24(20,2)12-10-21(18)23/h3-4,6,8,14,17-18,20-21,27H,5,7,9-13H2,1-2H3 |
| InChIKey | HSLRKIITGNGHCG-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.51 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|