C24H30N2OS — CID 46870810
(3S,10R,13S)-17-imidazo[2,1-b][1,3]thiazol-5-yl-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-ol (PubChem CID 46870810) has the molecular formula C24H30N2OS and a molecular weight of 394.58 g/mol. Its IUPAC name is (3S,10R,13S)-17-imidazo[2,1-b][1,3]thiazol-5-yl-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-ol.
| Compound Name | (3S,10R,13S)-17-imidazo[2,1-b][1,3]thiazol-5-yl-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 46870810 |
| Molecular Formula | C24H30N2OS |
| Molecular Weight | 394.58 g/mol |
| Exact Mass | 394.21 |
| IUPAC Name | (3S,10R,13S)-17-imidazo[2,1-b][1,3]thiazol-5-yl-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-ol |
| SMILES | C[C@]12CC[C@H](O)CC1=CCC1C2CC[C@]2(C)C(c3cnc4sccn34)=CCC12 |
| InChI | InChI=1S/C24H30N2OS/c1-23-9-7-16(27)13-15(23)3-4-17-18-5-6-20(24(18,2)10-8-19(17)23)21-14-25-22-26(21)11-12-28-22/h3,6,11-12,14,16-19,27H,4-5,7-10,13H2,1-2H3/t16-,17?,18?,19?,23-,24-/m0/s1 |
| InChIKey | ZJORNZFYSMVXCZ-VQRVXTSESA-N |
| XLogP | 5.71 |
| TPSA | 37.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.58 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|