C26H31NOS — CID 67992346
(3S,8R,9S,10R,13S,14S)-17-(2,1-benzothiazol-3-yl)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-ol (PubChem CID 67992346) has the molecular formula C26H31NOS and a molecular weight of 405.61 g/mol. Its IUPAC name is (3S,8R,9S,10R,13S,14S)-17-(2,1-benzothiazol-3-yl)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-ol.
| Compound Name | (3S,8R,9S,10R,13S,14S)-17-(2,1-benzothiazol-3-yl)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 67992346 |
| Molecular Formula | C26H31NOS |
| Molecular Weight | 405.61 g/mol |
| Exact Mass | 405.21 |
| IUPAC Name | (3S,8R,9S,10R,13S,14S)-17-(2,1-benzothiazol-3-yl)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-ol |
| SMILES | C[C@]12CC[C@H](O)CC1=CC[C@@H]1[C@@H]2CC[C@]2(C)C(c3snc4ccccc34)=CC[C@@H]12 |
| InChI | InChI=1S/C26H31NOS/c1-25-13-11-17(28)15-16(25)7-8-18-20-9-10-22(26(20,2)14-12-21(18)25)24-19-5-3-4-6-23(19)27-29-24/h3-7,10,17-18,20-21,28H,8-9,11-15H2,1-2H3/t17-,18-,20-,21-,25-,26-/m0/s1 |
| InChIKey | QUGNKRSKPMHXQO-YCUFAXBXSA-N |
| XLogP | 6.61 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.61 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|