C25H33NO — CID 10248168
(3S,8R,9S,10R,13S,14S)-10,13-dimethyl-17-(pyridin-2-ylmethyl)-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-ol (PubChem CID 10248168) has the molecular formula C25H33NO and a molecular weight of 363.55 g/mol. Its IUPAC name is (3S,8R,9S,10R,13S,14S)-10,13-dimethyl-17-(pyridin-2-ylmethyl)-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-ol.
| Compound Name | (3S,8R,9S,10R,13S,14S)-10,13-dimethyl-17-(pyridin-2-ylmethyl)-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 10248168 |
| Molecular Formula | C25H33NO |
| Molecular Weight | 363.55 g/mol |
| Exact Mass | 363.26 |
| IUPAC Name | (3S,8R,9S,10R,13S,14S)-10,13-dimethyl-17-(pyridin-2-ylmethyl)-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-ol |
| SMILES | C[C@]12CC[C@H](O)CC1=CC[C@@H]1[C@@H]2CC[C@]2(C)C(Cc3ccccn3)=CC[C@@H]12 |
| InChI | InChI=1S/C25H33NO/c1-24-12-10-20(27)16-18(24)6-8-21-22-9-7-17(15-19-5-3-4-14-26-19)25(22,2)13-11-23(21)24/h3-7,14,20-23,27H,8-13,15-16H2,1-2H3/t20-,21-,22-,23-,24-,25+/m0/s1 |
| InChIKey | LYEZZXKWQAOTRN-QXMOZHRRSA-N |
| XLogP | 5.48 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.55 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|